C16H21Cl2N — CID 114064368
1-[3-chloro-4-(chloromethyl)phenyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline (PubChem CID 114064368) has the molecular formula C16H21Cl2N and a molecular weight of 298.26 g/mol. Its IUPAC name is 1-[3-chloro-4-(chloromethyl)phenyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline.
| Compound Name | 1-[3-chloro-4-(chloromethyl)phenyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
|---|---|
| PubChem CID | 114064368 |
| Molecular Formula | C16H21Cl2N |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 1-[3-chloro-4-(chloromethyl)phenyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
| SMILES | ClCc1ccc(N2CCCC3CCCCC32)cc1Cl |
| InChI | InChI=1S/C16H21Cl2N/c17-11-13-7-8-14(10-15(13)18)19-9-3-5-12-4-1-2-6-16(12)19/h7-8,10,12,16H,1-6,9,11H2 |
| InChIKey | MBLYPXYBRZXQOB-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|