C17H25ClN2 — CID 102726748
1-[4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-chlorophenyl]ethanamine (PubChem CID 102726748) has the molecular formula C17H25ClN2 and a molecular weight of 292.85 g/mol. Its IUPAC name is 1-[4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-chlorophenyl]ethanamine.
| Compound Name | 1-[4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-chlorophenyl]ethanamine |
|---|---|
| PubChem CID | 102726748 |
| Molecular Formula | C17H25ClN2 |
| Molecular Weight | 292.85 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 1-[4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-chlorophenyl]ethanamine |
| SMILES | CC(N)c1ccc(N2CCC[C@H]3CCCC[C@H]32)cc1Cl |
| InChI | InChI=1S/C17H25ClN2/c1-12(19)15-9-8-14(11-16(15)18)20-10-4-6-13-5-2-3-7-17(13)20/h8-9,11-13,17H,2-7,10,19H2,1H3/t12?,13-,17-/m1/s1 |
| InChIKey | XBBOENODUWPYLT-QQGYXAEISA-N |
| XLogP | 4.52 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.85 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |