C16H23ClN2 — CID 65321011
(1R)-1-[4-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-3-chlorophenyl]ethanamine (PubChem CID 65321011) has the molecular formula C16H23ClN2 and a molecular weight of 278.83 g/mol. Its IUPAC name is (1R)-1-[4-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-3-chlorophenyl]ethanamine.
| Compound Name | (1R)-1-[4-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-3-chlorophenyl]ethanamine |
|---|---|
| PubChem CID | 65321011 |
| Molecular Formula | C16H23ClN2 |
| Molecular Weight | 278.83 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | (1R)-1-[4-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-3-chlorophenyl]ethanamine |
| SMILES | C[C@@H](N)c1ccc(N2CCCC3CCCC32)c(Cl)c1 |
| InChI | InChI=1S/C16H23ClN2/c1-11(18)13-7-8-16(14(17)10-13)19-9-3-5-12-4-2-6-15(12)19/h7-8,10-12,15H,2-6,9,18H2,1H3/t11-,12?,15?/m1/s1 |
| InChIKey | QEPZTVFRAQBHFE-XIKARTHZSA-N |
| XLogP | 4.13 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.83 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |