C22H20N4O3 — CID 11406597
ethyl 4-(4-hydroxyanilino)-3-methyl-1-phenylpyrazolo[3,4-b]pyridine-5-carboxylate (PubChem CID 11406597) has the molecular formula C22H20N4O3 and a molecular weight of 388.43 g/mol. Its IUPAC name is ethyl 4-(4-hydroxyanilino)-3-methyl-1-phenylpyrazolo[3,4-b]pyridine-5-carboxylate.
| Compound Name | ethyl 4-(4-hydroxyanilino)-3-methyl-1-phenylpyrazolo[3,4-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 11406597 |
| Molecular Formula | C22H20N4O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | ethyl 4-(4-hydroxyanilino)-3-methyl-1-phenylpyrazolo[3,4-b]pyridine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(c(C)nn2-c2ccccc2)c1Nc1ccc(O)cc1 |
| InChI | InChI=1S/C22H20N4O3/c1-3-29-22(28)18-13-23-21-19(20(18)24-15-9-11-17(27)12-10-15)14(2)25-26(21)16-7-5-4-6-8-16/h4-13,27H,3H2,1-2H3,(H,23,24) |
| InChIKey | DNSJTVSEDAQBPT-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|