C16H23BrClN — CID 114067889
2-(bromomethyl)-6-chloro-N-(4,4-dimethylcyclohexyl)-N-methylaniline (PubChem CID 114067889) has the molecular formula C16H23BrClN and a molecular weight of 344.72 g/mol. Its IUPAC name is 2-(bromomethyl)-6-chloro-N-(4,4-dimethylcyclohexyl)-N-methylaniline.
| Compound Name | 2-(bromomethyl)-6-chloro-N-(4,4-dimethylcyclohexyl)-N-methylaniline |
|---|---|
| PubChem CID | 114067889 |
| Molecular Formula | C16H23BrClN |
| Molecular Weight | 344.72 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 2-(bromomethyl)-6-chloro-N-(4,4-dimethylcyclohexyl)-N-methylaniline |
| SMILES | CN(c1c(Cl)cccc1CBr)C1CCC(C)(C)CC1 |
| InChI | InChI=1S/C16H23BrClN/c1-16(2)9-7-13(8-10-16)19(3)15-12(11-17)5-4-6-14(15)18/h4-6,13H,7-11H2,1-3H3 |
| InChIKey | GRUILXXWKHOIRF-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.72 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|