C11H8ClF2N3 — CID 114070537
6-chloro-2-N-(3,5-difluorophenyl)pyridine-2,4-diamine (PubChem CID 114070537) has the molecular formula C11H8ClF2N3 and a molecular weight of 255.66 g/mol. Its IUPAC name is 6-chloro-2-N-(3,5-difluorophenyl)pyridine-2,4-diamine.
| Compound Name | 6-chloro-2-N-(3,5-difluorophenyl)pyridine-2,4-diamine |
|---|---|
| PubChem CID | 114070537 |
| Molecular Formula | C11H8ClF2N3 |
| Molecular Weight | 255.66 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | 6-chloro-2-N-(3,5-difluorophenyl)pyridine-2,4-diamine |
| SMILES | Nc1cc(Cl)nc(Nc2cc(F)cc(F)c2)c1 |
| InChI | InChI=1S/C11H8ClF2N3/c12-10-4-8(15)5-11(17-10)16-9-2-6(13)1-7(14)3-9/h1-5H,(H3,15,16,17) |
| InChIKey | GNTDRGVONIWKJG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.66 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|