About 6-chloro-2-N-(3,5-difluorophenyl)pyridine-2,4-diamine
6-chloro-2-N-(3,5-difluorophenyl)pyridine-2,4-diamine (PubChem CID 114070537) has the molecular formula C11H8ClF2N3
and a molecular weight of 255.66 g/mol. Its IUPAC name is 6-chloro-2-N-(3,5-difluorophenyl)pyridine-2,4-diamine.
Molecular Properties
| Compound Name | 6-chloro-2-N-(3,5-difluorophenyl)pyridine-2,4-diamine |
| PubChem CID | 114070537 |
| Molecular Formula | C11H8ClF2N3 |
| Molecular Weight | 255.66 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | 6-chloro-2-N-(3,5-difluorophenyl)pyridine-2,4-diamine |
| SMILES | Nc1cc(Cl)nc(Nc2cc(F)cc(F)c2)c1 |
| InChI | InChI=1S/C11H8ClF2N3/c12-10-4-8(15)5-11(17-10)16-9-2-6(13)1-7(14)3-9/h1-5H,(H3,15,16,17) |
| InChIKey | GNTDRGVONIWKJG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.66 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-2-N-(3,5-difluorophenyl)pyridine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2-N-(3,5-difluorophenyl)pyridine-2,4-diamine?
The IUPAC name of 6-chloro-2-N-(3,5-difluorophenyl)pyridine-2,4-diamine (CID 114070537) is 6-chloro-2-N-(3,5-difluorophenyl)pyridine-2,4-diamine.
What is the SMILES notation for 6-chloro-2-N-(3,5-difluorophenyl)pyridine-2,4-diamine?
The canonical SMILES for 6-chloro-2-N-(3,5-difluorophenyl)pyridine-2,4-diamine is Nc1cc(Cl)nc(Nc2cc(F)cc(F)c2)c1.
What is the InChIKey of 6-chloro-2-N-(3,5-difluorophenyl)pyridine-2,4-diamine?
The InChIKey is GNTDRGVONIWKJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8ClF2N3/c12-10-4-8(15)5-11(17-10)16-9-2-6(13)1-7(14)3-9/h1-5H,(H3,15,16,17).
What are the key properties of 6-chloro-2-N-(3,5-difluorophenyl)pyridine-2,4-diamine?
6-chloro-2-N-(3,5-difluorophenyl)pyridine-2,4-diamine has a molecular weight of 255.66 g/mol, XLogP of 3.34, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-N-(3,5-difluorophenyl)pyridine-2,4-diamine is sourced from PubChem (CID 114070537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).