C11H8Cl2FN3 — CID 114070545
6-chloro-2-N-(5-chloro-2-fluorophenyl)pyridine-2,4-diamine (PubChem CID 114070545) has the molecular formula C11H8Cl2FN3 and a molecular weight of 272.11 g/mol. Its IUPAC name is 6-chloro-2-N-(5-chloro-2-fluorophenyl)pyridine-2,4-diamine.
| Compound Name | 6-chloro-2-N-(5-chloro-2-fluorophenyl)pyridine-2,4-diamine |
|---|---|
| PubChem CID | 114070545 |
| Molecular Formula | C11H8Cl2FN3 |
| Molecular Weight | 272.11 g/mol |
| Exact Mass | 271.01 |
| IUPAC Name | 6-chloro-2-N-(5-chloro-2-fluorophenyl)pyridine-2,4-diamine |
| SMILES | Nc1cc(Cl)nc(Nc2cc(Cl)ccc2F)c1 |
| InChI | InChI=1S/C11H8Cl2FN3/c12-6-1-2-8(14)9(3-6)16-11-5-7(15)4-10(13)17-11/h1-5H,(H3,15,16,17) |
| InChIKey | KGQLRXVPLGVOQU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.11 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|