C11H5Cl3N2O3 — CID 114070718
2-chloro-6-(2,5-dichlorophenoxy)-4-nitropyridine (PubChem CID 114070718) has the molecular formula C11H5Cl3N2O3 and a molecular weight of 319.53 g/mol. Its IUPAC name is 2-chloro-6-(2,5-dichlorophenoxy)-4-nitropyridine.
| Compound Name | 2-chloro-6-(2,5-dichlorophenoxy)-4-nitropyridine |
|---|---|
| PubChem CID | 114070718 |
| Molecular Formula | C11H5Cl3N2O3 |
| Molecular Weight | 319.53 g/mol |
| Exact Mass | 317.94 |
| IUPAC Name | 2-chloro-6-(2,5-dichlorophenoxy)-4-nitropyridine |
| SMILES | O=[N+]([O-])c1cc(Cl)nc(Oc2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C11H5Cl3N2O3/c12-6-1-2-8(13)9(3-6)19-11-5-7(16(17)18)4-10(14)15-11/h1-5H |
| InChIKey | NJEJGXIMBVVPFY-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.53 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|