C11H11ClN4O3 — CID 114070745
2-chloro-4-nitro-6-(1,3,5-trimethylpyrazol-4-yl)oxypyridine (PubChem CID 114070745) has the molecular formula C11H11ClN4O3 and a molecular weight of 282.69 g/mol. Its IUPAC name is 2-chloro-4-nitro-6-(1,3,5-trimethylpyrazol-4-yl)oxypyridine.
| Compound Name | 2-chloro-4-nitro-6-(1,3,5-trimethylpyrazol-4-yl)oxypyridine |
|---|---|
| PubChem CID | 114070745 |
| Molecular Formula | C11H11ClN4O3 |
| Molecular Weight | 282.69 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 2-chloro-4-nitro-6-(1,3,5-trimethylpyrazol-4-yl)oxypyridine |
| SMILES | Cc1nn(C)c(C)c1Oc1cc([N+](=O)[O-])cc(Cl)n1 |
| InChI | InChI=1S/C11H11ClN4O3/c1-6-11(7(2)15(3)14-6)19-10-5-8(16(17)18)4-9(12)13-10/h4-5H,1-3H3 |
| InChIKey | CCGGOJXHQANGMF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 83.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.69 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|