C10H5Br2ClN4O3 — CID 80740183
4-chloro-6-(2,6-dibromo-4-nitrophenoxy)pyrimidin-2-amine (PubChem CID 80740183) has the molecular formula C10H5Br2ClN4O3 and a molecular weight of 424.44 g/mol. Its IUPAC name is 4-chloro-6-(2,6-dibromo-4-nitrophenoxy)pyrimidin-2-amine.
| Compound Name | 4-chloro-6-(2,6-dibromo-4-nitrophenoxy)pyrimidin-2-amine |
|---|---|
| PubChem CID | 80740183 |
| Molecular Formula | C10H5Br2ClN4O3 |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 421.84 |
| IUPAC Name | 4-chloro-6-(2,6-dibromo-4-nitrophenoxy)pyrimidin-2-amine |
| SMILES | Nc1nc(Cl)cc(Oc2c(Br)cc([N+](=O)[O-])cc2Br)n1 |
| InChI | InChI=1S/C10H5Br2ClN4O3/c11-5-1-4(17(18)19)2-6(12)9(5)20-8-3-7(13)15-10(14)16-8/h1-3H,(H2,14,15,16) |
| InChIKey | FPHZQUQHSJAUQQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 104.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|