C12H6Br2N2O5 — CID 62253740
6-(2,6-dibromo-4-nitrophenoxy)pyridine-2-carboxylic acid (PubChem CID 62253740) has the molecular formula C12H6Br2N2O5 and a molecular weight of 418.00 g/mol. Its IUPAC name is 6-(2,6-dibromo-4-nitrophenoxy)pyridine-2-carboxylic acid.
| Compound Name | 6-(2,6-dibromo-4-nitrophenoxy)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 62253740 |
| Molecular Formula | C12H6Br2N2O5 |
| Molecular Weight | 418.00 g/mol |
| Exact Mass | 415.86 |
| IUPAC Name | 6-(2,6-dibromo-4-nitrophenoxy)pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cccc(Oc2c(Br)cc([N+](=O)[O-])cc2Br)n1 |
| InChI | InChI=1S/C12H6Br2N2O5/c13-7-4-6(16(19)20)5-8(14)11(7)21-10-3-1-2-9(15-10)12(17)18/h1-5H,(H,17,18) |
| InChIKey | LWLWZXPONXDAOV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 102.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.00 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|