C13H5Br3N2O3 — CID 114881658
2-bromo-6-(2,6-dibromo-4-nitrophenoxy)benzonitrile (PubChem CID 114881658) has the molecular formula C13H5Br3N2O3 and a molecular weight of 476.91 g/mol. Its IUPAC name is 2-bromo-6-(2,6-dibromo-4-nitrophenoxy)benzonitrile.
| Compound Name | 2-bromo-6-(2,6-dibromo-4-nitrophenoxy)benzonitrile |
|---|---|
| PubChem CID | 114881658 |
| Molecular Formula | C13H5Br3N2O3 |
| Molecular Weight | 476.91 g/mol |
| Exact Mass | 473.79 |
| IUPAC Name | 2-bromo-6-(2,6-dibromo-4-nitrophenoxy)benzonitrile |
| SMILES | N#Cc1c(Br)cccc1Oc1c(Br)cc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C13H5Br3N2O3/c14-9-2-1-3-12(8(9)6-17)21-13-10(15)4-7(18(19)20)5-11(13)16/h1-5H |
| InChIKey | NZYYZPZDNLWLAW-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 76.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.91 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|