C13H7Br2Cl2NO3 — CID 114847088
1,3-dibromo-2-[5-chloro-2-(chloromethyl)phenoxy]-5-nitrobenzene (PubChem CID 114847088) has the molecular formula C13H7Br2Cl2NO3 and a molecular weight of 455.92 g/mol. Its IUPAC name is 1,3-dibromo-2-[5-chloro-2-(chloromethyl)phenoxy]-5-nitrobenzene.
| Compound Name | 1,3-dibromo-2-[5-chloro-2-(chloromethyl)phenoxy]-5-nitrobenzene |
|---|---|
| PubChem CID | 114847088 |
| Molecular Formula | C13H7Br2Cl2NO3 |
| Molecular Weight | 455.92 g/mol |
| Exact Mass | 452.82 |
| IUPAC Name | 1,3-dibromo-2-[5-chloro-2-(chloromethyl)phenoxy]-5-nitrobenzene |
| SMILES | O=[N+]([O-])c1cc(Br)c(Oc2cc(Cl)ccc2CCl)c(Br)c1 |
| InChI | InChI=1S/C13H7Br2Cl2NO3/c14-10-4-9(18(19)20)5-11(15)13(10)21-12-3-8(17)2-1-7(12)6-16/h1-5H,6H2 |
| InChIKey | NYCJZOWASNEAQB-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.92 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|