C13H9Br2ClN2O3 — CID 81152432
[3-chloro-4-(2,6-dibromo-4-nitrophenoxy)phenyl]methanamine (PubChem CID 81152432) has the molecular formula C13H9Br2ClN2O3 and a molecular weight of 436.49 g/mol. Its IUPAC name is [3-chloro-4-(2,6-dibromo-4-nitrophenoxy)phenyl]methanamine.
| Compound Name | [3-chloro-4-(2,6-dibromo-4-nitrophenoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 81152432 |
| Molecular Formula | C13H9Br2ClN2O3 |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 433.87 |
| IUPAC Name | [3-chloro-4-(2,6-dibromo-4-nitrophenoxy)phenyl]methanamine |
| SMILES | NCc1ccc(Oc2c(Br)cc([N+](=O)[O-])cc2Br)c(Cl)c1 |
| InChI | InChI=1S/C13H9Br2ClN2O3/c14-9-4-8(18(19)20)5-10(15)13(9)21-12-2-1-7(6-17)3-11(12)16/h1-5H,6,17H2 |
| InChIKey | AFZHLEQNKGLVNL-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|