C9H14N4O4S — CID 114071220
6-N-methyl-6-N-(2-methylsulfonylethyl)-4-nitropyridine-2,6-diamine (PubChem CID 114071220) has the molecular formula C9H14N4O4S and a molecular weight of 274.30 g/mol. Its IUPAC name is 6-N-methyl-6-N-(2-methylsulfonylethyl)-4-nitropyridine-2,6-diamine.
| Compound Name | 6-N-methyl-6-N-(2-methylsulfonylethyl)-4-nitropyridine-2,6-diamine |
|---|---|
| PubChem CID | 114071220 |
| Molecular Formula | C9H14N4O4S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 6-N-methyl-6-N-(2-methylsulfonylethyl)-4-nitropyridine-2,6-diamine |
| SMILES | CN(CCS(C)(=O)=O)c1cc([N+](=O)[O-])cc(N)n1 |
| InChI | InChI=1S/C9H14N4O4S/c1-12(3-4-18(2,16)17)9-6-7(13(14)15)5-8(10)11-9/h5-6H,3-4H2,1-2H3,(H2,10,11) |
| InChIKey | HNUBJAYWFREWFQ-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 119.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|