C11H10BrClN4 — CID 114071876
5-bromo-4-N-(4-chlorophenyl)-6-N-methylpyrimidine-4,6-diamine (PubChem CID 114071876) has the molecular formula C11H10BrClN4 and a molecular weight of 313.59 g/mol. Its IUPAC name is 5-bromo-4-N-(4-chlorophenyl)-6-N-methylpyrimidine-4,6-diamine.
| Compound Name | 5-bromo-4-N-(4-chlorophenyl)-6-N-methylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 114071876 |
| Molecular Formula | C11H10BrClN4 |
| Molecular Weight | 313.59 g/mol |
| Exact Mass | 311.98 |
| IUPAC Name | 5-bromo-4-N-(4-chlorophenyl)-6-N-methylpyrimidine-4,6-diamine |
| SMILES | CNc1ncnc(Nc2ccc(Cl)cc2)c1Br |
| InChI | InChI=1S/C11H10BrClN4/c1-14-10-9(12)11(16-6-15-10)17-8-4-2-7(13)3-5-8/h2-6H,1H3,(H2,14,15,16,17) |
| InChIKey | AGTAHRKKYGIEOJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.59 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |