C11H5BrF4N2 — CID 114072596
N-(4-bromo-3-fluorophenyl)-3,5,6-trifluoropyridin-2-amine (PubChem CID 114072596) has the molecular formula C11H5BrF4N2 and a molecular weight of 321.07 g/mol. Its IUPAC name is N-(4-bromo-3-fluorophenyl)-3,5,6-trifluoropyridin-2-amine.
| Compound Name | N-(4-bromo-3-fluorophenyl)-3,5,6-trifluoropyridin-2-amine |
|---|---|
| PubChem CID | 114072596 |
| Molecular Formula | C11H5BrF4N2 |
| Molecular Weight | 321.07 g/mol |
| Exact Mass | 319.96 |
| IUPAC Name | N-(4-bromo-3-fluorophenyl)-3,5,6-trifluoropyridin-2-amine |
| SMILES | Fc1cc(Nc2nc(F)c(F)cc2F)ccc1Br |
| InChI | InChI=1S/C11H5BrF4N2/c12-6-2-1-5(3-7(6)13)17-11-9(15)4-8(14)10(16)18-11/h1-4H,(H,17,18) |
| InChIKey | VTSKWXAJWWXWIT-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.07 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|