C11H5F3N4 — CID 114072752
1-(3,5,6-trifluoro-2-pyridinyl)benzotriazole (PubChem CID 114072752) has the molecular formula C11H5F3N4 and a molecular weight of 250.18 g/mol. Its IUPAC name is 1-(3,5,6-trifluoro-2-pyridinyl)benzotriazole.
| Compound Name | 1-(3,5,6-trifluoro-2-pyridinyl)benzotriazole |
|---|---|
| PubChem CID | 114072752 |
| Molecular Formula | C11H5F3N4 |
| Molecular Weight | 250.18 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 1-(3,5,6-trifluoro-2-pyridinyl)benzotriazole |
| SMILES | Fc1cc(F)c(-n2nnc3ccccc32)nc1F |
| InChI | InChI=1S/C11H5F3N4/c12-6-5-7(13)11(15-10(6)14)18-9-4-2-1-3-8(9)16-17-18/h1-5H |
| InChIKey | KWAUAVWMTGMMQU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.18 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|