C12H9Cl2N5 — CID 102760218
6-(benzotriazol-1-yl)-3,5-dichloro-N-methylpyridin-2-amine (PubChem CID 102760218) has the molecular formula C12H9Cl2N5 and a molecular weight of 294.15 g/mol. Its IUPAC name is 6-(benzotriazol-1-yl)-3,5-dichloro-N-methylpyridin-2-amine.
| Compound Name | 6-(benzotriazol-1-yl)-3,5-dichloro-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 102760218 |
| Molecular Formula | C12H9Cl2N5 |
| Molecular Weight | 294.15 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | 6-(benzotriazol-1-yl)-3,5-dichloro-N-methylpyridin-2-amine |
| SMILES | CNc1nc(-n2nnc3ccccc32)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H9Cl2N5/c1-15-11-7(13)6-8(14)12(16-11)19-10-5-3-2-4-9(10)17-18-19/h2-6H,1H3,(H,15,16) |
| InChIKey | GHXRXMIPLVDRLA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.15 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |