About N-(2,6-dichloropyrimidin-4-yl)-3-(ethylamino)butanamide
N-(2,6-dichloropyrimidin-4-yl)-3-(ethylamino)butanamide (PubChem CID 114073216) has the molecular formula C10H14Cl2N4O
and a molecular weight of 277.16 g/mol. Its IUPAC name is N-(2,6-dichloropyrimidin-4-yl)-3-(ethylamino)butanamide.
Molecular Properties
| Compound Name | N-(2,6-dichloropyrimidin-4-yl)-3-(ethylamino)butanamide |
| PubChem CID | 114073216 |
| Molecular Formula | C10H14Cl2N4O |
| Molecular Weight | 277.16 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | N-(2,6-dichloropyrimidin-4-yl)-3-(ethylamino)butanamide |
| SMILES | CCNC(C)CC(=O)Nc1cc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C10H14Cl2N4O/c1-3-13-6(2)4-9(17)15-8-5-7(11)14-10(12)16-8/h5-6,13H,3-4H2,1-2H3,(H,14,15,16,17) |
| InChIKey | WVSCJVGSLCYBFU-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.16 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2,6-dichloropyrimidin-4-yl)-3-(ethylamino)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,6-dichloropyrimidin-4-yl)-3-(ethylamino)butanamide?
The IUPAC name of N-(2,6-dichloropyrimidin-4-yl)-3-(ethylamino)butanamide (CID 114073216) is N-(2,6-dichloropyrimidin-4-yl)-3-(ethylamino)butanamide.
What is the SMILES notation for N-(2,6-dichloropyrimidin-4-yl)-3-(ethylamino)butanamide?
The canonical SMILES for N-(2,6-dichloropyrimidin-4-yl)-3-(ethylamino)butanamide is CCNC(C)CC(=O)Nc1cc(Cl)nc(Cl)n1.
What is the InChIKey of N-(2,6-dichloropyrimidin-4-yl)-3-(ethylamino)butanamide?
The InChIKey is WVSCJVGSLCYBFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14Cl2N4O/c1-3-13-6(2)4-9(17)15-8-5-7(11)14-10(12)16-8/h5-6,13H,3-4H2,1-2H3,(H,14,15,16,17).
What are the key properties of N-(2,6-dichloropyrimidin-4-yl)-3-(ethylamino)butanamide?
N-(2,6-dichloropyrimidin-4-yl)-3-(ethylamino)butanamide has a molecular weight of 277.16 g/mol, XLogP of 2.11, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,6-dichloropyrimidin-4-yl)-3-(ethylamino)butanamide is sourced from PubChem (CID 114073216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).