C12H16F2N4O — CID 114073547
2-(3,5-difluoro-6-hydrazinyl-2-pyridinyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-ol (PubChem CID 114073547) has the molecular formula C12H16F2N4O and a molecular weight of 270.28 g/mol. Its IUPAC name is 2-(3,5-difluoro-6-hydrazinyl-2-pyridinyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-ol.
| Compound Name | 2-(3,5-difluoro-6-hydrazinyl-2-pyridinyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-ol |
|---|---|
| PubChem CID | 114073547 |
| Molecular Formula | C12H16F2N4O |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 2-(3,5-difluoro-6-hydrazinyl-2-pyridinyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-ol |
| SMILES | NNc1nc(N2CC3CCC(O)C3C2)c(F)cc1F |
| InChI | InChI=1S/C12H16F2N4O/c13-8-3-9(14)12(16-11(8)17-15)18-4-6-1-2-10(19)7(6)5-18/h3,6-7,10,19H,1-2,4-5,15H2,(H,16,17) |
| InChIKey | DSRFTZGNDAZWKG-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 74.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|