C11H16F2N4O2 — CID 114073629
[4-(3,5-difluoro-6-hydrazinyl-2-pyridinyl)-6-methylmorpholin-2-yl]methanol (PubChem CID 114073629) has the molecular formula C11H16F2N4O2 and a molecular weight of 274.27 g/mol. Its IUPAC name is [4-(3,5-difluoro-6-hydrazinyl-2-pyridinyl)-6-methylmorpholin-2-yl]methanol.
| Compound Name | [4-(3,5-difluoro-6-hydrazinyl-2-pyridinyl)-6-methylmorpholin-2-yl]methanol |
|---|---|
| PubChem CID | 114073629 |
| Molecular Formula | C11H16F2N4O2 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | [4-(3,5-difluoro-6-hydrazinyl-2-pyridinyl)-6-methylmorpholin-2-yl]methanol |
| SMILES | CC1CN(c2nc(NN)c(F)cc2F)CC(CO)O1 |
| InChI | InChI=1S/C11H16F2N4O2/c1-6-3-17(4-7(5-18)19-6)11-9(13)2-8(12)10(15-11)16-14/h2,6-7,18H,3-5,14H2,1H3,(H,15,16) |
| InChIKey | UUTODFVFDNTHNI-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|