C11H12BrN3OS — CID 114073949
5-bromo-N-ethyl-6-(2-methylfuran-3-yl)sulfanylpyrimidin-4-amine (PubChem CID 114073949) has the molecular formula C11H12BrN3OS and a molecular weight of 314.21 g/mol. Its IUPAC name is 5-bromo-N-ethyl-6-(2-methylfuran-3-yl)sulfanylpyrimidin-4-amine.
| Compound Name | 5-bromo-N-ethyl-6-(2-methylfuran-3-yl)sulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 114073949 |
| Molecular Formula | C11H12BrN3OS |
| Molecular Weight | 314.21 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | 5-bromo-N-ethyl-6-(2-methylfuran-3-yl)sulfanylpyrimidin-4-amine |
| SMILES | CCNc1ncnc(Sc2ccoc2C)c1Br |
| InChI | InChI=1S/C11H12BrN3OS/c1-3-13-10-9(12)11(15-6-14-10)17-8-4-5-16-7(8)2/h4-6H,3H2,1-2H3,(H,13,14,15) |
| InChIKey | IMSBEKACDXHWBO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.21 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |