C12H11BrFN3S — CID 114073920
5-bromo-N-ethyl-6-(3-fluorophenyl)sulfanylpyrimidin-4-amine (PubChem CID 114073920) has the molecular formula C12H11BrFN3S and a molecular weight of 328.21 g/mol. Its IUPAC name is 5-bromo-N-ethyl-6-(3-fluorophenyl)sulfanylpyrimidin-4-amine.
| Compound Name | 5-bromo-N-ethyl-6-(3-fluorophenyl)sulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 114073920 |
| Molecular Formula | C12H11BrFN3S |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 326.98 |
| IUPAC Name | 5-bromo-N-ethyl-6-(3-fluorophenyl)sulfanylpyrimidin-4-amine |
| SMILES | CCNc1ncnc(Sc2cccc(F)c2)c1Br |
| InChI | InChI=1S/C12H11BrFN3S/c1-2-15-11-10(13)12(17-7-16-11)18-9-5-3-4-8(14)6-9/h3-7H,2H2,1H3,(H,15,16,17) |
| InChIKey | YCIVMPOBDZHYHT-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |