C14H15F2N3S — CID 80887870
6-(3,4-difluorophenyl)sulfanyl-N,5-diethylpyrimidin-4-amine (PubChem CID 80887870) has the molecular formula C14H15F2N3S and a molecular weight of 295.36 g/mol. Its IUPAC name is 6-(3,4-difluorophenyl)sulfanyl-N,5-diethylpyrimidin-4-amine.
| Compound Name | 6-(3,4-difluorophenyl)sulfanyl-N,5-diethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80887870 |
| Molecular Formula | C14H15F2N3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 6-(3,4-difluorophenyl)sulfanyl-N,5-diethylpyrimidin-4-amine |
| SMILES | CCNc1ncnc(Sc2ccc(F)c(F)c2)c1CC |
| InChI | InChI=1S/C14H15F2N3S/c1-3-10-13(17-4-2)18-8-19-14(10)20-9-5-6-11(15)12(16)7-9/h5-8H,3-4H2,1-2H3,(H,17,18,19) |
| InChIKey | BFXOMUZSEMLAGT-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |