C13H13BrFN3S — CID 66304099
5-bromo-N-ethyl-2-[(3-fluorophenyl)sulfanylmethyl]pyrimidin-4-amine (PubChem CID 66304099) has the molecular formula C13H13BrFN3S and a molecular weight of 342.24 g/mol. Its IUPAC name is 5-bromo-N-ethyl-2-[(3-fluorophenyl)sulfanylmethyl]pyrimidin-4-amine.
| Compound Name | 5-bromo-N-ethyl-2-[(3-fluorophenyl)sulfanylmethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 66304099 |
| Molecular Formula | C13H13BrFN3S |
| Molecular Weight | 342.24 g/mol |
| Exact Mass | 341.00 |
| IUPAC Name | 5-bromo-N-ethyl-2-[(3-fluorophenyl)sulfanylmethyl]pyrimidin-4-amine |
| SMILES | CCNc1nc(CSc2cccc(F)c2)ncc1Br |
| InChI | InChI=1S/C13H13BrFN3S/c1-2-16-13-11(14)7-17-12(18-13)8-19-10-5-3-4-9(15)6-10/h3-7H,2,8H2,1H3,(H,16,17,18) |
| InChIKey | QETWKKNXZOGVIR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.24 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |