C9H14BrN3S — CID 66302260
5-bromo-N-ethyl-2-(ethylsulfanylmethyl)pyrimidin-4-amine (PubChem CID 66302260) has the molecular formula C9H14BrN3S and a molecular weight of 276.20 g/mol. Its IUPAC name is 5-bromo-N-ethyl-2-(ethylsulfanylmethyl)pyrimidin-4-amine.
| Compound Name | 5-bromo-N-ethyl-2-(ethylsulfanylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 66302260 |
| Molecular Formula | C9H14BrN3S |
| Molecular Weight | 276.20 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | 5-bromo-N-ethyl-2-(ethylsulfanylmethyl)pyrimidin-4-amine |
| SMILES | CCNc1nc(CSCC)ncc1Br |
| InChI | InChI=1S/C9H14BrN3S/c1-3-11-9-7(10)5-12-8(13-9)6-14-4-2/h5H,3-4,6H2,1-2H3,(H,11,12,13) |
| InChIKey | NCFWYABDEUAXJS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.20 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |