C11H18IN3S — CID 66302915
N-ethyl-5-iodo-2-(2-methylpropylsulfanylmethyl)pyrimidin-4-amine (PubChem CID 66302915) has the molecular formula C11H18IN3S and a molecular weight of 351.26 g/mol. Its IUPAC name is N-ethyl-5-iodo-2-(2-methylpropylsulfanylmethyl)pyrimidin-4-amine.
| Compound Name | N-ethyl-5-iodo-2-(2-methylpropylsulfanylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 66302915 |
| Molecular Formula | C11H18IN3S |
| Molecular Weight | 351.26 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | N-ethyl-5-iodo-2-(2-methylpropylsulfanylmethyl)pyrimidin-4-amine |
| SMILES | CCNc1nc(CSCC(C)C)ncc1I |
| InChI | InChI=1S/C11H18IN3S/c1-4-13-11-9(12)5-14-10(15-11)7-16-6-8(2)3/h5,8H,4,6-7H2,1-3H3,(H,13,14,15) |
| InChIKey | PEVLXLDXFKAWHG-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.26 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|