C12H18IN3S — CID 66304146
2-(cyclopentylsulfanylmethyl)-N-ethyl-5-iodopyrimidin-4-amine (PubChem CID 66304146) has the molecular formula C12H18IN3S and a molecular weight of 363.27 g/mol. Its IUPAC name is 2-(cyclopentylsulfanylmethyl)-N-ethyl-5-iodopyrimidin-4-amine.
| Compound Name | 2-(cyclopentylsulfanylmethyl)-N-ethyl-5-iodopyrimidin-4-amine |
|---|---|
| PubChem CID | 66304146 |
| Molecular Formula | C12H18IN3S |
| Molecular Weight | 363.27 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | 2-(cyclopentylsulfanylmethyl)-N-ethyl-5-iodopyrimidin-4-amine |
| SMILES | CCNc1nc(CSC2CCCC2)ncc1I |
| InChI | InChI=1S/C12H18IN3S/c1-2-14-12-10(13)7-15-11(16-12)8-17-9-5-3-4-6-9/h7,9H,2-6,8H2,1H3,(H,14,15,16) |
| InChIKey | NXJSSZSWEVKIJT-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.27 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|