C13H20Br2N2O — CID 114077381
3-[[2-amino-1-(3,4-dibromophenyl)ethyl]amino]pentan-1-ol (PubChem CID 114077381) has the molecular formula C13H20Br2N2O and a molecular weight of 380.12 g/mol. Its IUPAC name is 3-[[2-amino-1-(3,4-dibromophenyl)ethyl]amino]pentan-1-ol.
| Compound Name | 3-[[2-amino-1-(3,4-dibromophenyl)ethyl]amino]pentan-1-ol |
|---|---|
| PubChem CID | 114077381 |
| Molecular Formula | C13H20Br2N2O |
| Molecular Weight | 380.12 g/mol |
| Exact Mass | 377.99 |
| IUPAC Name | 3-[[2-amino-1-(3,4-dibromophenyl)ethyl]amino]pentan-1-ol |
| SMILES | CCC(CCO)NC(CN)c1ccc(Br)c(Br)c1 |
| InChI | InChI=1S/C13H20Br2N2O/c1-2-10(5-6-18)17-13(8-16)9-3-4-11(14)12(15)7-9/h3-4,7,10,13,17-18H,2,5-6,8,16H2,1H3 |
| InChIKey | CHPIYVIQOXRIPS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.12 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |