C14H19Br2NO2 — CID 114077402
ethyl 2-(butan-2-ylamino)-2-(3,4-dibromophenyl)acetate (PubChem CID 114077402) has the molecular formula C14H19Br2NO2 and a molecular weight of 393.12 g/mol. Its IUPAC name is ethyl 2-(butan-2-ylamino)-2-(3,4-dibromophenyl)acetate.
| Compound Name | ethyl 2-(butan-2-ylamino)-2-(3,4-dibromophenyl)acetate |
|---|---|
| PubChem CID | 114077402 |
| Molecular Formula | C14H19Br2NO2 |
| Molecular Weight | 393.12 g/mol |
| Exact Mass | 390.98 |
| IUPAC Name | ethyl 2-(butan-2-ylamino)-2-(3,4-dibromophenyl)acetate |
| SMILES | CCOC(=O)C(NC(C)CC)c1ccc(Br)c(Br)c1 |
| InChI | InChI=1S/C14H19Br2NO2/c1-4-9(3)17-13(14(18)19-5-2)10-6-7-11(15)12(16)8-10/h6-9,13,17H,4-5H2,1-3H3 |
| InChIKey | CBTHEQJLQSRTJH-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.12 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |