C11H8Br3N3 — CID 114077544
5-bromo-2-(3,4-dibromophenyl)-N-methylpyrimidin-4-amine (PubChem CID 114077544) has the molecular formula C11H8Br3N3 and a molecular weight of 421.92 g/mol. Its IUPAC name is 5-bromo-2-(3,4-dibromophenyl)-N-methylpyrimidin-4-amine.
| Compound Name | 5-bromo-2-(3,4-dibromophenyl)-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 114077544 |
| Molecular Formula | C11H8Br3N3 |
| Molecular Weight | 421.92 g/mol |
| Exact Mass | 418.83 |
| IUPAC Name | 5-bromo-2-(3,4-dibromophenyl)-N-methylpyrimidin-4-amine |
| SMILES | CNc1nc(-c2ccc(Br)c(Br)c2)ncc1Br |
| InChI | InChI=1S/C11H8Br3N3/c1-15-11-9(14)5-16-10(17-11)6-2-3-7(12)8(13)4-6/h2-5H,1H3,(H,15,16,17) |
| InChIKey | FMTOIXSLOYDHJE-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.92 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |