C12H9BrF3N3 — CID 66297991
5-bromo-N-methyl-2-[4-(trifluoromethyl)phenyl]pyrimidin-4-amine (PubChem CID 66297991) has the molecular formula C12H9BrF3N3 and a molecular weight of 332.12 g/mol. Its IUPAC name is 5-bromo-N-methyl-2-[4-(trifluoromethyl)phenyl]pyrimidin-4-amine.
| Compound Name | 5-bromo-N-methyl-2-[4-(trifluoromethyl)phenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 66297991 |
| Molecular Formula | C12H9BrF3N3 |
| Molecular Weight | 332.12 g/mol |
| Exact Mass | 330.99 |
| IUPAC Name | 5-bromo-N-methyl-2-[4-(trifluoromethyl)phenyl]pyrimidin-4-amine |
| SMILES | CNc1nc(-c2ccc(C(F)(F)F)cc2)ncc1Br |
| InChI | InChI=1S/C12H9BrF3N3/c1-17-11-9(13)6-18-10(19-11)7-2-4-8(5-3-7)12(14,15)16/h2-6H,1H3,(H,17,18,19) |
| InChIKey | GBCXWFIIOJXJFT-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.12 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |