About (Z)-N-tert-butyl-3-(3,4-dibromophenyl)-2-methylprop-2-en-1-amine
(Z)-N-tert-butyl-3-(3,4-dibromophenyl)-2-methylprop-2-en-1-amine (PubChem CID 114077605) has the molecular formula C14H19Br2N
and a molecular weight of 361.12 g/mol. Its IUPAC name is (Z)-N-tert-butyl-3-(3,4-dibromophenyl)-2-methylprop-2-en-1-amine.
Molecular Properties
| Compound Name | (Z)-N-tert-butyl-3-(3,4-dibromophenyl)-2-methylprop-2-en-1-amine |
| PubChem CID | 114077605 |
| Molecular Formula | C14H19Br2N |
| Molecular Weight | 361.12 g/mol |
| Exact Mass | 358.99 |
| IUPAC Name | (Z)-N-tert-butyl-3-(3,4-dibromophenyl)-2-methylprop-2-en-1-amine |
| SMILES | C/C(=C/c1ccc(Br)c(Br)c1)CNC(C)(C)C |
| InChI | InChI=1S/C14H19Br2N/c1-10(9-17-14(2,3)4)7-11-5-6-12(15)13(16)8-11/h5-8,17H,9H2,1-4H3/b10-7- |
| InChIKey | JLTQDYYPDZRZGB-YFHOEESVSA-N |
| XLogP | 5.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 361.12 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (Z)-N-tert-butyl-3-(3,4-dibromophenyl)-2-methylprop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-tert-butyl-3-(3,4-dibromophenyl)-2-methylprop-2-en-1-amine?
The IUPAC name of (Z)-N-tert-butyl-3-(3,4-dibromophenyl)-2-methylprop-2-en-1-amine (CID 114077605) is (Z)-N-tert-butyl-3-(3,4-dibromophenyl)-2-methylprop-2-en-1-amine.
What is the SMILES notation for (Z)-N-tert-butyl-3-(3,4-dibromophenyl)-2-methylprop-2-en-1-amine?
The canonical SMILES for (Z)-N-tert-butyl-3-(3,4-dibromophenyl)-2-methylprop-2-en-1-amine is C/C(=C/c1ccc(Br)c(Br)c1)CNC(C)(C)C.
What is the InChIKey of (Z)-N-tert-butyl-3-(3,4-dibromophenyl)-2-methylprop-2-en-1-amine?
The InChIKey is JLTQDYYPDZRZGB-YFHOEESVSA-N. The full InChI is InChI=1S/C14H19Br2N/c1-10(9-17-14(2,3)4)7-11-5-6-12(15)13(16)8-11/h5-8,17H,9H2,1-4H3/b10-7-.
What are the key properties of (Z)-N-tert-butyl-3-(3,4-dibromophenyl)-2-methylprop-2-en-1-amine?
(Z)-N-tert-butyl-3-(3,4-dibromophenyl)-2-methylprop-2-en-1-amine has a molecular weight of 361.12 g/mol, XLogP of 5.00, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-tert-butyl-3-(3,4-dibromophenyl)-2-methylprop-2-en-1-amine is sourced from PubChem (CID 114077605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).