4-[methyl-[(2,4,5-trimethylphenyl)methyl]amino]butanoic acid

C15H23NO2 — CID 114078387

IUPAC4-[methyl-[(2,4,5-trimethylphenyl)methyl]amino]butanoic acid
SMILESCc1cc(C)c(CN(C)CCCC(=O)O)cc1C
InChIInChI=1S/C15H23NO2/c1-11-8-13(3)14(9-12(11)2)10-16(4)7-5-6-15(17)18/h8-9H,5-7,10H2,1-4H3,(H,17,18)
InChIKeyXLRAZSDSMPNAIQ-UHFFFAOYSA-N
MW249.35 g/mol
LogP2.91
Rot. Bonds6

About 4-[methyl-[(2,4,5-trimethylphenyl)methyl]amino]butanoic acid

4-[methyl-[(2,4,5-trimethylphenyl)methyl]amino]butanoic acid (PubChem CID 114078387) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 4-[methyl-[(2,4,5-trimethylphenyl)methyl]amino]butanoic acid.

Molecular Properties

Compound Name4-[methyl-[(2,4,5-trimethylphenyl)methyl]amino]butanoic acid
PubChem CID114078387
Molecular FormulaC15H23NO2
Molecular Weight249.35 g/mol
Exact Mass249.17
IUPAC Name4-[methyl-[(2,4,5-trimethylphenyl)methyl]amino]butanoic acid
SMILESCc1cc(C)c(CN(C)CCCC(=O)O)cc1C
InChIInChI=1S/C15H23NO2/c1-11-8-13(3)14(9-12(11)2)10-16(4)7-5-6-15(17)18/h8-9H,5-7,10H2,1-4H3,(H,17,18)
InChIKeyXLRAZSDSMPNAIQ-UHFFFAOYSA-N
XLogP2.91
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.35
LogP ≤ 52.91
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4-[methyl-[(2,4,5-trimethylphenyl)methyl]amino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[methyl-[(2,4,5-trimethylphenyl)methyl]amino]butanoic acid?
The IUPAC name of 4-[methyl-[(2,4,5-trimethylphenyl)methyl]amino]butanoic acid (CID 114078387) is 4-[methyl-[(2,4,5-trimethylphenyl)methyl]amino]butanoic acid.
What is the SMILES notation for 4-[methyl-[(2,4,5-trimethylphenyl)methyl]amino]butanoic acid?
The canonical SMILES for 4-[methyl-[(2,4,5-trimethylphenyl)methyl]amino]butanoic acid is Cc1cc(C)c(CN(C)CCCC(=O)O)cc1C.
What is the InChIKey of 4-[methyl-[(2,4,5-trimethylphenyl)methyl]amino]butanoic acid?
The InChIKey is XLRAZSDSMPNAIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO2/c1-11-8-13(3)14(9-12(11)2)10-16(4)7-5-6-15(17)18/h8-9H,5-7,10H2,1-4H3,(H,17,18).
What are the key properties of 4-[methyl-[(2,4,5-trimethylphenyl)methyl]amino]butanoic acid?
4-[methyl-[(2,4,5-trimethylphenyl)methyl]amino]butanoic acid has a molecular weight of 249.35 g/mol, XLogP of 2.91, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[methyl-[(2,4,5-trimethylphenyl)methyl]amino]butanoic acid is sourced from PubChem (CID 114078387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).