C15H23NO2 — CID 115219079
5-[(2,4-dimethylphenyl)methyl-methylamino]pentanoic acid (PubChem CID 115219079) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 5-[(2,4-dimethylphenyl)methyl-methylamino]pentanoic acid.
| Compound Name | 5-[(2,4-dimethylphenyl)methyl-methylamino]pentanoic acid |
|---|---|
| PubChem CID | 115219079 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 5-[(2,4-dimethylphenyl)methyl-methylamino]pentanoic acid |
| SMILES | Cc1ccc(CN(C)CCCCC(=O)O)c(C)c1 |
| InChI | InChI=1S/C15H23NO2/c1-12-7-8-14(13(2)10-12)11-16(3)9-5-4-6-15(17)18/h7-8,10H,4-6,9,11H2,1-3H3,(H,17,18) |
| InChIKey | XZHPXEPVTYEFLB-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|