C14H19NO2 — CID 115237184
(E)-4-[(2,4-dimethylphenyl)methyl-methylamino]but-2-enoic acid (PubChem CID 115237184) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is (E)-4-[(2,4-dimethylphenyl)methyl-methylamino]but-2-enoic acid.
| Compound Name | (E)-4-[(2,4-dimethylphenyl)methyl-methylamino]but-2-enoic acid |
|---|---|
| PubChem CID | 115237184 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | (E)-4-[(2,4-dimethylphenyl)methyl-methylamino]but-2-enoic acid |
| SMILES | Cc1ccc(CN(C)C/C=C/C(=O)O)c(C)c1 |
| InChI | InChI=1S/C14H19NO2/c1-11-6-7-13(12(2)9-11)10-15(3)8-4-5-14(16)17/h4-7,9H,8,10H2,1-3H3,(H,16,17)/b5-4+ |
| InChIKey | XYXFBMHARWHCAK-SNAWJCMRSA-N |
| XLogP | 2.38 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|