C11H13N3O3 — CID 114078696
4-[[(5-methyl-1,2,4-oxadiazol-3-yl)methylamino]methyl]benzene-1,3-diol (PubChem CID 114078696) has the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. Its IUPAC name is 4-[[(5-methyl-1,2,4-oxadiazol-3-yl)methylamino]methyl]benzene-1,3-diol.
| Compound Name | 4-[[(5-methyl-1,2,4-oxadiazol-3-yl)methylamino]methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 114078696 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 4-[[(5-methyl-1,2,4-oxadiazol-3-yl)methylamino]methyl]benzene-1,3-diol |
| SMILES | Cc1nc(CNCc2ccc(O)cc2O)no1 |
| InChI | InChI=1S/C11H13N3O3/c1-7-13-11(14-17-7)6-12-5-8-2-3-9(15)4-10(8)16/h2-4,12,15-16H,5-6H2,1H3 |
| InChIKey | OXEVMIWHMYKATN-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|