C13H21N3O3 — CID 114082270
3-methyl-1-[2-oxo-2-(4-oxopiperidin-1-yl)ethyl]pyrrolidine-3-carboxamide (PubChem CID 114082270) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is 3-methyl-1-[2-oxo-2-(4-oxopiperidin-1-yl)ethyl]pyrrolidine-3-carboxamide.
| Compound Name | 3-methyl-1-[2-oxo-2-(4-oxopiperidin-1-yl)ethyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 114082270 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 3-methyl-1-[2-oxo-2-(4-oxopiperidin-1-yl)ethyl]pyrrolidine-3-carboxamide |
| SMILES | CC1(C(N)=O)CCN(CC(=O)N2CCC(=O)CC2)C1 |
| InChI | InChI=1S/C13H21N3O3/c1-13(12(14)19)4-7-15(9-13)8-11(18)16-5-2-10(17)3-6-16/h2-9H2,1H3,(H2,14,19) |
| InChIKey | RXNUUTDDBXDSCB-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |