C14H20N2O2S — CID 114082271
1-[2-(5-ethylthiophen-2-yl)-2-oxoethyl]-3-methylpyrrolidine-3-carboxamide (PubChem CID 114082271) has the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. Its IUPAC name is 1-[2-(5-ethylthiophen-2-yl)-2-oxoethyl]-3-methylpyrrolidine-3-carboxamide.
| Compound Name | 1-[2-(5-ethylthiophen-2-yl)-2-oxoethyl]-3-methylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 114082271 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 1-[2-(5-ethylthiophen-2-yl)-2-oxoethyl]-3-methylpyrrolidine-3-carboxamide |
| SMILES | CCc1ccc(C(=O)CN2CCC(C)(C(N)=O)C2)s1 |
| InChI | InChI=1S/C14H20N2O2S/c1-3-10-4-5-12(19-10)11(17)8-16-7-6-14(2,9-16)13(15)18/h4-5H,3,6-9H2,1-2H3,(H2,15,18) |
| InChIKey | OKTJKOKLMWSJAO-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |