C14H21NOS2 — CID 114237526
1-(5-ethylthiophen-2-yl)-2-(4-methylsulfanylpiperidin-1-yl)ethanone (PubChem CID 114237526) has the molecular formula C14H21NOS2 and a molecular weight of 283.46 g/mol. Its IUPAC name is 1-(5-ethylthiophen-2-yl)-2-(4-methylsulfanylpiperidin-1-yl)ethanone.
| Compound Name | 1-(5-ethylthiophen-2-yl)-2-(4-methylsulfanylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 114237526 |
| Molecular Formula | C14H21NOS2 |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 1-(5-ethylthiophen-2-yl)-2-(4-methylsulfanylpiperidin-1-yl)ethanone |
| SMILES | CCc1ccc(C(=O)CN2CCC(SC)CC2)s1 |
| InChI | InChI=1S/C14H21NOS2/c1-3-11-4-5-14(18-11)13(16)10-15-8-6-12(17-2)7-9-15/h4-5,12H,3,6-10H2,1-2H3 |
| InChIKey | DYRZSDWZPDNBBA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |