C15H23NO2S — CID 62050766
1-(5-ethylthiophen-2-yl)-2-[2-(2-hydroxyethyl)piperidin-1-yl]ethanone (PubChem CID 62050766) has the molecular formula C15H23NO2S and a molecular weight of 281.42 g/mol. Its IUPAC name is 1-(5-ethylthiophen-2-yl)-2-[2-(2-hydroxyethyl)piperidin-1-yl]ethanone.
| Compound Name | 1-(5-ethylthiophen-2-yl)-2-[2-(2-hydroxyethyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 62050766 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 1-(5-ethylthiophen-2-yl)-2-[2-(2-hydroxyethyl)piperidin-1-yl]ethanone |
| SMILES | CCc1ccc(C(=O)CN2CCCCC2CCO)s1 |
| InChI | InChI=1S/C15H23NO2S/c1-2-13-6-7-15(19-13)14(18)11-16-9-4-3-5-12(16)8-10-17/h6-7,12,17H,2-5,8-11H2,1H3 |
| InChIKey | XSDATSAFYVSQMJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |