C12H10Br2ClNS — CID 114082819
2,6-dibromo-N-[1-(5-chlorothiophen-3-yl)ethyl]aniline (PubChem CID 114082819) has the molecular formula C12H10Br2ClNS and a molecular weight of 395.55 g/mol. Its IUPAC name is 2,6-dibromo-N-[1-(5-chlorothiophen-3-yl)ethyl]aniline.
| Compound Name | 2,6-dibromo-N-[1-(5-chlorothiophen-3-yl)ethyl]aniline |
|---|---|
| PubChem CID | 114082819 |
| Molecular Formula | C12H10Br2ClNS |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 392.86 |
| IUPAC Name | 2,6-dibromo-N-[1-(5-chlorothiophen-3-yl)ethyl]aniline |
| SMILES | CC(Nc1c(Br)cccc1Br)c1csc(Cl)c1 |
| InChI | InChI=1S/C12H10Br2ClNS/c1-7(8-5-11(15)17-6-8)16-12-9(13)3-2-4-10(12)14/h2-7,16H,1H3 |
| InChIKey | WKPTYWMUFLBTPO-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |