C12H10ClF2NS — CID 114082630
N-[1-(5-chlorothiophen-3-yl)ethyl]-3,5-difluoroaniline (PubChem CID 114082630) has the molecular formula C12H10ClF2NS and a molecular weight of 273.74 g/mol. Its IUPAC name is N-[1-(5-chlorothiophen-3-yl)ethyl]-3,5-difluoroaniline.
| Compound Name | N-[1-(5-chlorothiophen-3-yl)ethyl]-3,5-difluoroaniline |
|---|---|
| PubChem CID | 114082630 |
| Molecular Formula | C12H10ClF2NS |
| Molecular Weight | 273.74 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | N-[1-(5-chlorothiophen-3-yl)ethyl]-3,5-difluoroaniline |
| SMILES | CC(Nc1cc(F)cc(F)c1)c1csc(Cl)c1 |
| InChI | InChI=1S/C12H10ClF2NS/c1-7(8-2-12(13)17-6-8)16-11-4-9(14)3-10(15)5-11/h2-7,16H,1H3 |
| InChIKey | VEOPIPAYDCHGAU-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.74 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |