C10H18N4O2S — CID 114083330
5-(1,1-dioxo-1,4-thiazepan-4-yl)-1,3-dimethylpyrazol-4-amine (PubChem CID 114083330) has the molecular formula C10H18N4O2S and a molecular weight of 258.35 g/mol. Its IUPAC name is 5-(1,1-dioxo-1,4-thiazepan-4-yl)-1,3-dimethylpyrazol-4-amine.
| Compound Name | 5-(1,1-dioxo-1,4-thiazepan-4-yl)-1,3-dimethylpyrazol-4-amine |
|---|---|
| PubChem CID | 114083330 |
| Molecular Formula | C10H18N4O2S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 5-(1,1-dioxo-1,4-thiazepan-4-yl)-1,3-dimethylpyrazol-4-amine |
| SMILES | Cc1nn(C)c(N2CCCS(=O)(=O)CC2)c1N |
| InChI | InChI=1S/C10H18N4O2S/c1-8-9(11)10(13(2)12-8)14-4-3-6-17(15,16)7-5-14/h3-7,11H2,1-2H3 |
| InChIKey | YUOZCNCKUFQQSS-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |