C11H14ClN3O3S — CID 114083529
4-chloro-6-(1,1-dioxo-1,4-thiazepan-4-yl)-2-methylpyrimidine-5-carbaldehyde (PubChem CID 114083529) has the molecular formula C11H14ClN3O3S and a molecular weight of 303.77 g/mol. Its IUPAC name is 4-chloro-6-(1,1-dioxo-1,4-thiazepan-4-yl)-2-methylpyrimidine-5-carbaldehyde.
| Compound Name | 4-chloro-6-(1,1-dioxo-1,4-thiazepan-4-yl)-2-methylpyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 114083529 |
| Molecular Formula | C11H14ClN3O3S |
| Molecular Weight | 303.77 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 4-chloro-6-(1,1-dioxo-1,4-thiazepan-4-yl)-2-methylpyrimidine-5-carbaldehyde |
| SMILES | Cc1nc(Cl)c(C=O)c(N2CCCS(=O)(=O)CC2)n1 |
| InChI | InChI=1S/C11H14ClN3O3S/c1-8-13-10(12)9(7-16)11(14-8)15-3-2-5-19(17,18)6-4-15/h7H,2-6H2,1H3 |
| InChIKey | XFUPDUCCCKYHSM-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 80.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.77 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|