C11H16N2O3S — CID 114083554
[2-(1,1-dioxo-1,4-thiazepan-4-yl)-3-pyridinyl]methanol (PubChem CID 114083554) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is [2-(1,1-dioxo-1,4-thiazepan-4-yl)-3-pyridinyl]methanol.
| Compound Name | [2-(1,1-dioxo-1,4-thiazepan-4-yl)-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 114083554 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | [2-(1,1-dioxo-1,4-thiazepan-4-yl)-3-pyridinyl]methanol |
| SMILES | O=S1(=O)CCCN(c2ncccc2CO)CC1 |
| InChI | InChI=1S/C11H16N2O3S/c14-9-10-3-1-4-12-11(10)13-5-2-7-17(15,16)8-6-13/h1,3-4,14H,2,5-9H2 |
| InChIKey | LNPOPVLGUXVAJY-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |