About [2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-fluoro-4-pyridinyl]methanamine
[2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-fluoro-4-pyridinyl]methanamine (PubChem CID 105389165) has the molecular formula C10H14FN3O2S
and a molecular weight of 259.31 g/mol. Its IUPAC name is [2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-fluoro-4-pyridinyl]methanamine.
Molecular Properties
| Compound Name | [2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-fluoro-4-pyridinyl]methanamine |
| PubChem CID | 105389165 |
| Molecular Formula | C10H14FN3O2S |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | [2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-fluoro-4-pyridinyl]methanamine |
| SMILES | NCc1ccnc(N2CCS(=O)(=O)CC2)c1F |
| InChI | InChI=1S/C10H14FN3O2S/c11-9-8(7-12)1-2-13-10(9)14-3-5-17(15,16)6-4-14/h1-2H,3-7,12H2 |
| InChIKey | WUKJJFONQWVTSI-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-fluoro-4-pyridinyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-fluoro-4-pyridinyl]methanamine?
The IUPAC name of [2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-fluoro-4-pyridinyl]methanamine (CID 105389165) is [2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-fluoro-4-pyridinyl]methanamine.
What is the SMILES notation for [2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-fluoro-4-pyridinyl]methanamine?
The canonical SMILES for [2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-fluoro-4-pyridinyl]methanamine is NCc1ccnc(N2CCS(=O)(=O)CC2)c1F.
What is the InChIKey of [2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-fluoro-4-pyridinyl]methanamine?
The InChIKey is WUKJJFONQWVTSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14FN3O2S/c11-9-8(7-12)1-2-13-10(9)14-3-5-17(15,16)6-4-14/h1-2H,3-7,12H2.
What are the key properties of [2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-fluoro-4-pyridinyl]methanamine?
[2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-fluoro-4-pyridinyl]methanamine has a molecular weight of 259.31 g/mol, XLogP of -0.09, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-fluoro-4-pyridinyl]methanamine is sourced from PubChem (CID 105389165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).