C12H16FN3 — CID 105389495
[2-(2-azabicyclo[2.2.1]heptan-2-yl)-3-fluoro-4-pyridinyl]methanamine (PubChem CID 105389495) has the molecular formula C12H16FN3 and a molecular weight of 221.28 g/mol. Its IUPAC name is [2-(2-azabicyclo[2.2.1]heptan-2-yl)-3-fluoro-4-pyridinyl]methanamine.
| Compound Name | [2-(2-azabicyclo[2.2.1]heptan-2-yl)-3-fluoro-4-pyridinyl]methanamine |
|---|---|
| PubChem CID | 105389495 |
| Molecular Formula | C12H16FN3 |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | [2-(2-azabicyclo[2.2.1]heptan-2-yl)-3-fluoro-4-pyridinyl]methanamine |
| SMILES | NCc1ccnc(N2CC3CCC2C3)c1F |
| InChI | InChI=1S/C12H16FN3/c13-11-9(6-14)3-4-15-12(11)16-7-8-1-2-10(16)5-8/h3-4,8,10H,1-2,5-7,14H2 |
| InChIKey | NVSIRQRCKRPIKT-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |