About [3-fluoro-2-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)-4-pyridinyl]methanamine
[3-fluoro-2-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)-4-pyridinyl]methanamine (PubChem CID 105389866) has the molecular formula C16H18FN3
and a molecular weight of 271.34 g/mol. Its IUPAC name is [3-fluoro-2-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)-4-pyridinyl]methanamine.
Molecular Properties
| Compound Name | [3-fluoro-2-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)-4-pyridinyl]methanamine |
| PubChem CID | 105389866 |
| Molecular Formula | C16H18FN3 |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | [3-fluoro-2-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)-4-pyridinyl]methanamine |
| SMILES | CC1Cc2ccccc2N(c2nccc(CN)c2F)C1 |
| InChI | InChI=1S/C16H18FN3/c1-11-8-12-4-2-3-5-14(12)20(10-11)16-15(17)13(9-18)6-7-19-16/h2-7,11H,8-10,18H2,1H3 |
| InChIKey | OAKKOFRQNQRQJA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-fluoro-2-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)-4-pyridinyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-fluoro-2-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)-4-pyridinyl]methanamine?
The IUPAC name of [3-fluoro-2-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)-4-pyridinyl]methanamine (CID 105389866) is [3-fluoro-2-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)-4-pyridinyl]methanamine.
What is the SMILES notation for [3-fluoro-2-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)-4-pyridinyl]methanamine?
The canonical SMILES for [3-fluoro-2-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)-4-pyridinyl]methanamine is CC1Cc2ccccc2N(c2nccc(CN)c2F)C1.
What is the InChIKey of [3-fluoro-2-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)-4-pyridinyl]methanamine?
The InChIKey is OAKKOFRQNQRQJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18FN3/c1-11-8-12-4-2-3-5-14(12)20(10-11)16-15(17)13(9-18)6-7-19-16/h2-7,11H,8-10,18H2,1H3.
What are the key properties of [3-fluoro-2-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)-4-pyridinyl]methanamine?
[3-fluoro-2-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)-4-pyridinyl]methanamine has a molecular weight of 271.34 g/mol, XLogP of 3.01, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-fluoro-2-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)-4-pyridinyl]methanamine is sourced from PubChem (CID 105389866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).